C10H20N2S — CID 43439588
4-ethyl-N-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43439588) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 4-ethyl-N-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43439588 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-ethyl-N-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1CSC(NC(CC)CC)=N1 |
| InChI | InChI=1S/C10H20N2S/c1-4-8(5-2)11-10-12-9(6-3)7-13-10/h8-9H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | HJAUDHJLCXABMP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |