C10H18N2OS — CID 43610489
4-ethyl-N-(oxan-4-yl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43610489) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 4-ethyl-N-(oxan-4-yl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(oxan-4-yl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43610489 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-ethyl-N-(oxan-4-yl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1CSC(NC2CCOCC2)=N1 |
| InChI | InChI=1S/C10H18N2OS/c1-2-8-7-14-10(11-8)12-9-3-5-13-6-4-9/h8-9H,2-7H2,1H3,(H,11,12) |
| InChIKey | BNLQGHMAFIUSPN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |