C13H16N2S — CID 63261342
4-benzyl-N-cyclopropyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 63261342) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 4-benzyl-N-cyclopropyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-benzyl-N-cyclopropyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63261342 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-benzyl-N-cyclopropyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | c1ccc(CC2CSC(NC3CC3)=N2)cc1 |
| InChI | InChI=1S/C13H16N2S/c1-2-4-10(5-3-1)8-12-9-16-13(15-12)14-11-6-7-11/h1-5,11-12H,6-9H2,(H,14,15) |
| InChIKey | CXKWWLNEMYNWPG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |