C16H18N2OS — CID 63261747
4-benzyl-N-[1-(furan-2-yl)ethyl]-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 63261747) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-benzyl-N-[1-(furan-2-yl)ethyl]-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-benzyl-N-[1-(furan-2-yl)ethyl]-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63261747 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-benzyl-N-[1-(furan-2-yl)ethyl]-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(NC1=NC(Cc2ccccc2)CS1)c1ccco1 |
| InChI | InChI=1S/C16H18N2OS/c1-12(15-8-5-9-19-15)17-16-18-14(11-20-16)10-13-6-3-2-4-7-13/h2-9,12,14H,10-11H2,1H3,(H,17,18) |
| InChIKey | NCYFYKFWOMAZOV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |