C16H25N3 — CID 10658971
(4S)-4-benzyl-N,1-di(propan-2-yl)-4,5-dihydroimidazol-2-amine (PubChem CID 10658971) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (4S)-4-benzyl-N,1-di(propan-2-yl)-4,5-dihydroimidazol-2-amine.
| Compound Name | (4S)-4-benzyl-N,1-di(propan-2-yl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 10658971 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (4S)-4-benzyl-N,1-di(propan-2-yl)-4,5-dihydroimidazol-2-amine |
| SMILES | CC(C)NC1=N[C@@H](Cc2ccccc2)CN1C(C)C |
| InChI | InChI=1S/C16H25N3/c1-12(2)17-16-18-15(11-19(16)13(3)4)10-14-8-6-5-7-9-14/h5-9,12-13,15H,10-11H2,1-4H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | JCMSKEIVDFSFRW-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |