C16H24N2S — CID 63261356
4-benzyl-N-hexan-2-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 63261356) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 4-benzyl-N-hexan-2-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-benzyl-N-hexan-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63261356 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-benzyl-N-hexan-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCCCC(C)NC1=NC(Cc2ccccc2)CS1 |
| InChI | InChI=1S/C16H24N2S/c1-3-4-8-13(2)17-16-18-15(12-19-16)11-14-9-6-5-7-10-14/h5-7,9-10,13,15H,3-4,8,11-12H2,1-2H3,(H,17,18) |
| InChIKey | ZORZYXFFQDJGID-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |