C9H15N3O4 — CID 43441026
1-[2-(carbamoylamino)-2-oxoethyl]piperidine-2-carboxylic acid (PubChem CID 43441026) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)-2-oxoethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(carbamoylamino)-2-oxoethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43441026 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-[2-(carbamoylamino)-2-oxoethyl]piperidine-2-carboxylic acid |
| SMILES | NC(=O)NC(=O)CN1CCCCC1C(=O)O |
| InChI | InChI=1S/C9H15N3O4/c10-9(16)11-7(13)5-12-4-2-1-3-6(12)8(14)15/h6H,1-5H2,(H,14,15)(H3,10,11,13,16) |
| InChIKey | DJFIHOSTEFXDEN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |