C9H14N2O5 — CID 43442143
1-[2-(methoxycarbonylamino)-2-oxoethyl]pyrrolidine-2-carboxylic acid (PubChem CID 43442143) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[2-(methoxycarbonylamino)-2-oxoethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(methoxycarbonylamino)-2-oxoethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43442143 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-[2-(methoxycarbonylamino)-2-oxoethyl]pyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)NC(=O)CN1CCCC1C(=O)O |
| InChI | InChI=1S/C9H14N2O5/c1-16-9(15)10-7(12)5-11-4-2-3-6(11)8(13)14/h6H,2-5H2,1H3,(H,13,14)(H,10,12,15) |
| InChIKey | VLZFWXLONPNDRC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |