C14H18FNO2S — CID 43441261
1-[2-(4-fluorophenyl)sulfanylethyl]piperidine-2-carboxylic acid (PubChem CID 43441261) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)sulfanylethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(4-fluorophenyl)sulfanylethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43441261 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[2-(4-fluorophenyl)sulfanylethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO2S/c15-11-4-6-12(7-5-11)19-10-9-16-8-2-1-3-13(16)14(17)18/h4-7,13H,1-3,8-10H2,(H,17,18) |
| InChIKey | AEFYNVJJGVRGOH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |