C11H11NO5 — CID 43447565
3-[(2,6-dioxopiperidin-1-yl)methyl]furan-2-carboxylic acid (PubChem CID 43447565) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 3-[(2,6-dioxopiperidin-1-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(2,6-dioxopiperidin-1-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43447565 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-[(2,6-dioxopiperidin-1-yl)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1CN1C(=O)CCCC1=O |
| InChI | InChI=1S/C11H11NO5/c13-8-2-1-3-9(14)12(8)6-7-4-5-17-10(7)11(15)16/h4-5H,1-3,6H2,(H,15,16) |
| InChIKey | MBYVLRPZEMAZCZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|