C10H16Cl2N2O3 — CID 50988437
3-(piperazin-1-ylmethyl)furan-2-carboxylic acid;dihydrochloride (PubChem CID 50988437) has the molecular formula C10H16Cl2N2O3 and a molecular weight of 283.15 g/mol. Its IUPAC name is 3-(piperazin-1-ylmethyl)furan-2-carboxylic acid;dihydrochloride.
| Compound Name | 3-(piperazin-1-ylmethyl)furan-2-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 50988437 |
| Molecular Formula | C10H16Cl2N2O3 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-(piperazin-1-ylmethyl)furan-2-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)c1occc1CN1CCNCC1 |
| InChI | InChI=1S/C10H14N2O3.2ClH/c13-10(14)9-8(1-6-15-9)7-12-4-2-11-3-5-12;;/h1,6,11H,2-5,7H2,(H,13,14);2*1H |
| InChIKey | RUKLPZDLFIVLSX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |