C11H15N3S — CID 43451418
5-N-methyl-5-N-propyl-1,3-benzothiazole-4,5-diamine (PubChem CID 43451418) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 5-N-methyl-5-N-propyl-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-methyl-5-N-propyl-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 43451418 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-N-methyl-5-N-propyl-1,3-benzothiazole-4,5-diamine |
| SMILES | CCCN(C)c1ccc2scnc2c1N |
| InChI | InChI=1S/C11H15N3S/c1-3-6-14(2)8-4-5-9-11(10(8)12)13-7-15-9/h4-5,7H,3,6,12H2,1-2H3 |
| InChIKey | NDSOSYGZBXQIDD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|