C11H14N2OS — CID 43451985
5-amino-6-propylsulfanyl-1,3-dihydroindol-2-one (PubChem CID 43451985) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-amino-6-propylsulfanyl-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-propylsulfanyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43451985 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-amino-6-propylsulfanyl-1,3-dihydroindol-2-one |
| SMILES | CCCSc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C11H14N2OS/c1-2-3-15-10-6-9-7(4-8(10)12)5-11(14)13-9/h4,6H,2-3,5,12H2,1H3,(H,13,14) |
| InChIKey | VDBVILYOBCSQQX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|