C12H17N3O2 — CID 43455612
6-amino-7-[2-hydroxyethyl(methyl)amino]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43455612) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-amino-7-[2-hydroxyethyl(methyl)amino]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-[2-hydroxyethyl(methyl)amino]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43455612 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-amino-7-[2-hydroxyethyl(methyl)amino]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CN(CCO)c1cc2c(cc1N)CCC(=O)N2 |
| InChI | InChI=1S/C12H17N3O2/c1-15(4-5-16)11-7-10-8(6-9(11)13)2-3-12(17)14-10/h6-7,16H,2-5,13H2,1H3,(H,14,17) |
| InChIKey | WTMZDZZTKSZOCV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|