C14H14FNO3 — CID 43457544
7-fluoro-6-(oxolane-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43457544) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 7-fluoro-6-(oxolane-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-fluoro-6-(oxolane-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43457544 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 7-fluoro-6-(oxolane-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)C3CCCO3)c(F)cc2N1 |
| InChI | InChI=1S/C14H14FNO3/c15-10-7-11-8(3-4-13(17)16-11)6-9(10)14(18)12-2-1-5-19-12/h6-7,12H,1-5H2,(H,16,17) |
| InChIKey | VLYUJFGEKHFSBT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |