About 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one
5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 43160614) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one |
| PubChem CID | 43160614 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)C3CCCO3)ccc2N1 |
| InChI | InChI=1S/C13H13NO3/c15-12-7-9-6-8(3-4-10(9)14-12)13(16)11-2-1-5-17-11/h3-4,6,11H,1-2,5,7H2,(H,14,15) |
| InChIKey | VGZHEIKTSCFGMT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one?
The IUPAC name of 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one (CID 43160614) is 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one is O=C1Cc2cc(C(=O)C3CCCO3)ccc2N1.
What is the InChIKey of 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one?
The InChIKey is VGZHEIKTSCFGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c15-12-7-9-6-8(3-4-10(9)14-12)13(16)11-2-1-5-17-11/h3-4,6,11H,1-2,5,7H2,(H,14,15).
What are the key properties of 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one?
5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one has a molecular weight of 231.25 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 43160614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).