C13H13NO3 — CID 43160614
5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 43160614) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43160614 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-(oxolane-2-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)C3CCCO3)ccc2N1 |
| InChI | InChI=1S/C13H13NO3/c15-12-7-9-6-8(3-4-10(9)14-12)13(16)11-2-1-5-17-11/h3-4,6,11H,1-2,5,7H2,(H,14,15) |
| InChIKey | VGZHEIKTSCFGMT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |