C14H15NO3 — CID 79759211
5-(2-methyloxolane-3-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 79759211) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(2-methyloxolane-3-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-methyloxolane-3-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79759211 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 5-(2-methyloxolane-3-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | CC1OCCC1C(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H15NO3/c1-8-11(4-5-18-8)14(17)9-2-3-12-10(6-9)7-13(16)15-12/h2-3,6,8,11H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | GCDSCBJRYMAZKM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |