C14H16ClNO2 — CID 79762985
5-[chloro-(2-methyloxolan-3-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 79762985) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-[chloro-(2-methyloxolan-3-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[chloro-(2-methyloxolan-3-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79762985 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-[chloro-(2-methyloxolan-3-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | CC1OCCC1C(Cl)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H16ClNO2/c1-8-11(4-5-18-8)14(15)9-2-3-12-10(6-9)7-13(17)16-12/h2-3,6,8,11,14H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | WKYKFVLISMTPFC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|