C14H12ClNO2 — CID 61083783
5-[chloro-(5-methylfuran-2-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 61083783) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 5-[chloro-(5-methylfuran-2-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[chloro-(5-methylfuran-2-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61083783 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-[chloro-(5-methylfuran-2-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc(C(Cl)c2ccc3c(c2)CC(=O)N3)o1 |
| InChI | InChI=1S/C14H12ClNO2/c1-8-2-5-12(18-8)14(15)9-3-4-11-10(6-9)7-13(17)16-11/h2-6,14H,7H2,1H3,(H,16,17) |
| InChIKey | ZOUFBGGGESHWRD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|