C15H11ClINO — CID 61086610
5-[chloro-(2-iodophenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 61086610) has the molecular formula C15H11ClINO and a molecular weight of 383.62 g/mol. Its IUPAC name is 5-[chloro-(2-iodophenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[chloro-(2-iodophenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61086610 |
| Molecular Formula | C15H11ClINO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 5-[chloro-(2-iodophenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Cl)c3ccccc3I)ccc2N1 |
| InChI | InChI=1S/C15H11ClINO/c16-15(11-3-1-2-4-12(11)17)9-5-6-13-10(7-9)8-14(19)18-13/h1-7,15H,8H2,(H,18,19) |
| InChIKey | UTALMXQLMQXLDU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|