C14H12ClNOS — CID 61083583
5-[chloro-(3-methylthiophen-2-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 61083583) has the molecular formula C14H12ClNOS and a molecular weight of 277.78 g/mol. Its IUPAC name is 5-[chloro-(3-methylthiophen-2-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[chloro-(3-methylthiophen-2-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61083583 |
| Molecular Formula | C14H12ClNOS |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 5-[chloro-(3-methylthiophen-2-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1ccsc1C(Cl)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H12ClNOS/c1-8-4-5-18-14(8)13(15)9-2-3-11-10(6-9)7-12(17)16-11/h2-6,13H,7H2,1H3,(H,16,17) |
| InChIKey | YLNRJALGNPKPTA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|