C13H21N3O — CID 43458331
2-[(4-aminophenyl)methyl-methylamino]-N,N-dimethylpropanamide (PubChem CID 43458331) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl-methylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(4-aminophenyl)methyl-methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43458331 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-[(4-aminophenyl)methyl-methylamino]-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)N(C)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C13H21N3O/c1-10(13(17)15(2)3)16(4)9-11-5-7-12(14)8-6-11/h5-8,10H,9,14H2,1-4H3 |
| InChIKey | CSSFBLCACOERJE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|