C11H18N2O2 — CID 18472400
2-[(4-aminophenyl)methyl-methylamino]propane-1,3-diol (PubChem CID 18472400) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl-methylamino]propane-1,3-diol.
| Compound Name | 2-[(4-aminophenyl)methyl-methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 18472400 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[(4-aminophenyl)methyl-methylamino]propane-1,3-diol |
| SMILES | CN(Cc1ccc(N)cc1)C(CO)CO |
| InChI | InChI=1S/C11H18N2O2/c1-13(11(7-14)8-15)6-9-2-4-10(12)5-3-9/h2-5,11,14-15H,6-8,12H2,1H3 |
| InChIKey | VOFNNRMJAAMDJR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|