C16H20N2O2 — CID 43459243
N-[(2-aminophenyl)methyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide (PubChem CID 43459243) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(2-aminophenyl)methyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 43459243 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide |
| SMILES | CCN(Cc1ccccc1N)C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C16H20N2O2/c1-4-18(10-13-7-5-6-8-15(13)17)16(19)14-9-11(2)20-12(14)3/h5-9H,4,10,17H2,1-3H3 |
| InChIKey | ZGHCTFNJUPHXGV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|