C16H20N2O2 — CID 63230482
N-(2-aminophenyl)-2,5-dimethyl-N-propylfuran-3-carboxamide (PubChem CID 63230482) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(2-aminophenyl)-2,5-dimethyl-N-propylfuran-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-2,5-dimethyl-N-propylfuran-3-carboxamide |
|---|---|
| PubChem CID | 63230482 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(2-aminophenyl)-2,5-dimethyl-N-propylfuran-3-carboxamide |
| SMILES | CCCN(C(=O)c1cc(C)oc1C)c1ccccc1N |
| InChI | InChI=1S/C16H20N2O2/c1-4-9-18(15-8-6-5-7-14(15)17)16(19)13-10-11(2)20-12(13)3/h5-8,10H,4,9,17H2,1-3H3 |
| InChIKey | HXJADPMCEMVQRG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|