C14H23N3O — CID 79154664
1-(2-aminophenyl)-3,3-diethyl-1-propylurea (PubChem CID 79154664) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3,3-diethyl-1-propylurea.
| Compound Name | 1-(2-aminophenyl)-3,3-diethyl-1-propylurea |
|---|---|
| PubChem CID | 79154664 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-(2-aminophenyl)-3,3-diethyl-1-propylurea |
| SMILES | CCCN(C(=O)N(CC)CC)c1ccccc1N |
| InChI | InChI=1S/C14H23N3O/c1-4-11-17(14(18)16(5-2)6-3)13-10-8-7-9-12(13)15/h7-10H,4-6,11,15H2,1-3H3 |
| InChIKey | FVDPLRZHGHZBNI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|