C14H11NO5 — CID 43463830
(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-nitrofuran-2-yl)methanone (PubChem CID 43463830) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-nitrofuran-2-yl)methanone.
| Compound Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 43463830 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-nitrofuran-2-yl)methanone |
| SMILES | CC1Cc2cc(C(=O)c3ccc([N+](=O)[O-])o3)ccc2O1 |
| InChI | InChI=1S/C14H11NO5/c1-8-6-10-7-9(2-3-11(10)19-8)14(16)12-4-5-13(20-12)15(17)18/h2-5,7-8H,6H2,1H3 |
| InChIKey | XZKALEMZABPZHL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|