C13H12N2O5 — CID 43463989
2,3-dihydro-1,4-benzodioxin-6-yl-(5-nitrofuran-2-yl)methanamine (PubChem CID 43463989) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-(5-nitrofuran-2-yl)methanamine.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(5-nitrofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 43463989 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(5-nitrofuran-2-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)OCCO2)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H12N2O5/c14-13(10-3-4-12(20-10)15(16)17)8-1-2-9-11(7-8)19-6-5-18-9/h1-4,7,13H,5-6,14H2 |
| InChIKey | WUWMFTVFTJVERG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|