C11H13NS2 — CID 43464516
(2,5-dimethylthiophen-3-yl)-thiophen-2-ylmethanamine (PubChem CID 43464516) has the molecular formula C11H13NS2 and a molecular weight of 223.37 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-thiophen-2-ylmethanamine.
| Compound Name | (2,5-dimethylthiophen-3-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 43464516 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-thiophen-2-ylmethanamine |
| SMILES | Cc1cc(C(N)c2cccs2)c(C)s1 |
| InChI | InChI=1S/C11H13NS2/c1-7-6-9(8(2)14-7)11(12)10-4-3-5-13-10/h3-6,11H,12H2,1-2H3 |
| InChIKey | GZYSJPGXRDHQLP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |