C13H14INS — CID 43124905
(2,5-dimethylthiophen-3-yl)-(4-iodophenyl)methanamine (PubChem CID 43124905) has the molecular formula C13H14INS and a molecular weight of 343.23 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(4-iodophenyl)methanamine.
| Compound Name | (2,5-dimethylthiophen-3-yl)-(4-iodophenyl)methanamine |
|---|---|
| PubChem CID | 43124905 |
| Molecular Formula | C13H14INS |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(4-iodophenyl)methanamine |
| SMILES | Cc1cc(C(N)c2ccc(I)cc2)c(C)s1 |
| InChI | InChI=1S/C13H14INS/c1-8-7-12(9(2)16-8)13(15)10-3-5-11(14)6-4-10/h3-7,13H,15H2,1-2H3 |
| InChIKey | BAIZZNWAVNETMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|