C10H13N3S — CID 82236049
(2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanamine (PubChem CID 82236049) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanamine.
| Compound Name | (2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 82236049 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanamine |
| SMILES | Cc1cc(C(N)c2cn[nH]c2)c(C)s1 |
| InChI | InChI=1S/C10H13N3S/c1-6-3-9(7(2)14-6)10(11)8-4-12-13-5-8/h3-5,10H,11H2,1-2H3,(H,12,13) |
| InChIKey | AVBHKACNJOKRKF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |