About (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine
(4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine (PubChem CID 131111170) has the molecular formula C7H10N6
and a molecular weight of 178.20 g/mol. Its IUPAC name is (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine |
| PubChem CID | 131111170 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine |
| SMILES | Cn1cnnc1C(N)c1cn[nH]c1 |
| InChI | InChI=1S/C7H10N6/c1-13-4-11-12-7(13)6(8)5-2-9-10-3-5/h2-4,6H,8H2,1H3,(H,9,10) |
| InChIKey | OQVDERKHZBSNGA-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine?
The IUPAC name of (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine (CID 131111170) is (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine.
What is the SMILES notation for (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine?
The canonical SMILES for (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine is Cn1cnnc1C(N)c1cn[nH]c1.
What is the InChIKey of (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine?
The InChIKey is OQVDERKHZBSNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6/c1-13-4-11-12-7(13)6(8)5-2-9-10-3-5/h2-4,6H,8H2,1H3,(H,9,10).
What are the key properties of (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine?
(4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine has a molecular weight of 178.20 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,2,4-triazol-3-yl)-(1H-pyrazol-4-yl)methanamine is sourced from PubChem (CID 131111170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).