C9H11N3S — CID 82236060
(3-methylthiophen-2-yl)-(1H-pyrazol-4-yl)methanamine (PubChem CID 82236060) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is (3-methylthiophen-2-yl)-(1H-pyrazol-4-yl)methanamine.
| Compound Name | (3-methylthiophen-2-yl)-(1H-pyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 82236060 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3-methylthiophen-2-yl)-(1H-pyrazol-4-yl)methanamine |
| SMILES | Cc1ccsc1C(N)c1cn[nH]c1 |
| InChI | InChI=1S/C9H11N3S/c1-6-2-3-13-9(6)8(10)7-4-11-12-5-7/h2-5,8H,10H2,1H3,(H,11,12) |
| InChIKey | YOCVPWHBMSMMBW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |