3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid

C9H14N2O3 — CID 43468274

IUPAC3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid
SMILESCC(C)C(NCc1ccno1)C(=O)O
InChIInChI=1S/C9H14N2O3/c1-6(2)8(9(12)13)10-5-7-3-4-11-14-7/h3-4,6,8,10H,5H2,1-2H3,(H,12,13)
InChIKeyIQXFQEKPZHSRKU-UHFFFAOYSA-N
MW198.22 g/mol
LogP0.87
Rot. Bonds5

About 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid

3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid (PubChem CID 43468274) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid.

Molecular Properties

Compound Name3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid
PubChem CID43468274
Molecular FormulaC9H14N2O3
Molecular Weight198.22 g/mol
Exact Mass198.10
IUPAC Name3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid
SMILESCC(C)C(NCc1ccno1)C(=O)O
InChIInChI=1S/C9H14N2O3/c1-6(2)8(9(12)13)10-5-7-3-4-11-14-7/h3-4,6,8,10H,5H2,1-2H3,(H,12,13)
InChIKeyIQXFQEKPZHSRKU-UHFFFAOYSA-N
XLogP0.87
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid?
The IUPAC name of 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid (CID 43468274) is 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid.
What is the SMILES notation for 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid?
The canonical SMILES for 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid is CC(C)C(NCc1ccno1)C(=O)O.
What is the InChIKey of 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid?
The InChIKey is IQXFQEKPZHSRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-6(2)8(9(12)13)10-5-7-3-4-11-14-7/h3-4,6,8,10H,5H2,1-2H3,(H,12,13).
What are the key properties of 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid?
3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid has a molecular weight of 198.22 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1,2-oxazol-5-ylmethylamino)butanoic acid is sourced from PubChem (CID 43468274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).