About (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate
(3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate (PubChem CID 43469136) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate |
| PubChem CID | 43469136 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate |
| SMILES | COc1cccc(COC(=O)Nc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C15H16N2O3/c1-19-14-4-2-3-11(9-14)10-20-15(18)17-13-7-5-12(16)6-8-13/h2-9H,10,16H2,1H3,(H,17,18) |
| InChIKey | UEGZKKMPHXIDML-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate?
The IUPAC name of (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate (CID 43469136) is (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate.
What is the SMILES notation for (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate?
The canonical SMILES for (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate is COc1cccc(COC(=O)Nc2ccc(N)cc2)c1.
What is the InChIKey of (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate?
The InChIKey is UEGZKKMPHXIDML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-19-14-4-2-3-11(9-14)10-20-15(18)17-13-7-5-12(16)6-8-13/h2-9H,10,16H2,1H3,(H,17,18).
What are the key properties of (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate?
(3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate has a molecular weight of 272.30 g/mol, XLogP of 3.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl N-(4-aminophenyl)carbamate is sourced from PubChem (CID 43469136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).