C14H20N2O4 — CID 43469733
2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid (PubChem CID 43469733) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid.
| Compound Name | 2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 43469733 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)c1c(C)cc(C)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c1-4-5-6-10(14(19)20)16-13(18)11-8(2)7-9(3)15-12(11)17/h7,10H,4-6H2,1-3H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | HVLPRWZIQZYGOM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |