C14H20N2O5 — CID 81085835
2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-5-methoxypentanoic acid (PubChem CID 81085835) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-5-methoxypentanoic acid.
| Compound Name | 2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81085835 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)c1c(C)cc(C)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C14H20N2O5/c1-8-7-9(2)15-12(17)11(8)13(18)16-10(14(19)20)5-4-6-21-3/h7,10H,4-6H2,1-3H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | WPMUNYUIDZPDMG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|