C13H19N3O5 — CID 81085336
2-[(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]-5-methoxypentanoic acid (PubChem CID 81085336) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]-5-methoxypentanoic acid.
| Compound Name | 2-[(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81085336 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)c1c(C)c(C)n[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C13H19N3O5/c1-7-8(2)15-16-12(18)10(7)11(17)14-9(13(19)20)5-4-6-21-3/h9H,4-6H2,1-3H3,(H,14,17)(H,16,18)(H,19,20) |
| InChIKey | BILDCBPDVTVFNH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|