C16H20O3 — CID 43473193
2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid (PubChem CID 43473193) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid.
| Compound Name | 2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 43473193 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid |
| SMILES | CC1CC=CCC1COCc1ccccc1C(=O)O |
| InChI | InChI=1S/C16H20O3/c1-12-6-2-3-7-13(12)10-19-11-14-8-4-5-9-15(14)16(17)18/h2-5,8-9,12-13H,6-7,10-11H2,1H3,(H,17,18) |
| InChIKey | MMQLLPTVAUYTHT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|