C9H16N2O3 — CID 43473432
4-[[2-oxo-2-(prop-2-enylamino)ethyl]amino]butanoic acid (PubChem CID 43473432) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-[[2-oxo-2-(prop-2-enylamino)ethyl]amino]butanoic acid.
| Compound Name | 4-[[2-oxo-2-(prop-2-enylamino)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43473432 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 4-[[2-oxo-2-(prop-2-enylamino)ethyl]amino]butanoic acid |
| SMILES | C=CCNC(=O)CNCCCC(=O)O |
| InChI | InChI=1S/C9H16N2O3/c1-2-5-11-8(12)7-10-6-3-4-9(13)14/h2,10H,1,3-7H2,(H,11,12)(H,13,14) |
| InChIKey | LUNVZRARRMAHQW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|