C13H11NO3S2 — CID 43474309
5-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylic acid (PubChem CID 43474309) has the molecular formula C13H11NO3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43474309 |
| Molecular Formula | C13H11NO3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 5-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylic acid |
| SMILES | Cc1ccsc1/C=C/C(=O)Nc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C13H11NO3S2/c1-8-6-7-18-9(8)2-4-11(15)14-12-5-3-10(19-12)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)/b4-2+ |
| InChIKey | XPBPXWUCNUQCED-DUXPYHPUSA-N |
| XLogP | 3.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|