C14H13NO3S2 — CID 43013639
methyl 3-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylate (PubChem CID 43013639) has the molecular formula C14H13NO3S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43013639 |
| Molecular Formula | C14H13NO3S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | methyl 3-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)/C=C/c1sccc1C |
| InChI | InChI=1S/C14H13NO3S2/c1-9-5-7-19-11(9)3-4-12(16)15-10-6-8-20-13(10)14(17)18-2/h3-8H,1-2H3,(H,15,16)/b4-3+ |
| InChIKey | FIVRMWPCXQPALE-ONEGZZNKSA-N |
| XLogP | 3.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|