C15H11ClFNO3S — CID 36670448
methyl 3-[[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate (PubChem CID 36670448) has the molecular formula C15H11ClFNO3S and a molecular weight of 339.78 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 36670448 |
| Molecular Formula | C15H11ClFNO3S |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | methyl 3-[[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClFNO3S/c1-21-15(20)14-12(6-7-22-14)18-13(19)5-3-9-2-4-11(17)10(16)8-9/h2-8H,1H3,(H,18,19)/b5-3+ |
| InChIKey | ADKUIZBCNHLGHX-HWKANZROSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|