C16H26N4S — CID 43476440
N-[[6-(2-ethylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]propan-1-amine (PubChem CID 43476440) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is N-[[6-(2-ethylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[6-(2-ethylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43476440 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[[6-(2-ethylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1c(N2CCCCC2CC)nc2sccn12 |
| InChI | InChI=1S/C16H26N4S/c1-3-8-17-12-14-15(18-16-20(14)10-11-21-16)19-9-6-5-7-13(19)4-2/h10-11,13,17H,3-9,12H2,1-2H3 |
| InChIKey | WENQKDPHGBVCRU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|