C14H21N5OS — CID 63608220
3-methyl-4-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]piperazin-2-one (PubChem CID 63608220) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-methyl-4-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]piperazin-2-one.
| Compound Name | 3-methyl-4-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]piperazin-2-one |
|---|---|
| PubChem CID | 63608220 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-methyl-4-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]piperazin-2-one |
| SMILES | CCCNCc1c(N2CCNC(=O)C2C)nc2sccn12 |
| InChI | InChI=1S/C14H21N5OS/c1-3-4-15-9-11-12(17-14-19(11)7-8-21-14)18-6-5-16-13(20)10(18)2/h7-8,10,15H,3-6,9H2,1-2H3,(H,16,20) |
| InChIKey | HAXNNZJYTUQJNU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|