C12H13N7S — CID 62951049
1-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,2,4-triazole-3-carbonitrile (PubChem CID 62951049) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 62951049 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,2,4-triazole-3-carbonitrile |
| SMILES | CCCNCc1c(-n2cnc(C#N)n2)nc2sccn12 |
| InChI | InChI=1S/C12H13N7S/c1-2-3-14-7-9-11(16-12-18(9)4-5-20-12)19-8-15-10(6-13)17-19/h4-5,8,14H,2-3,7H2,1H3 |
| InChIKey | WBWUHUDGWYHSEU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|