C17H26O4 — CID 43477221
2-methyl-5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]furan-3-carboxylic acid (PubChem CID 43477221) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-methyl-5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43477221 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-methyl-5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(COC2CC(C)CCC2C(C)C)cc1C(=O)O |
| InChI | InChI=1S/C17H26O4/c1-10(2)14-6-5-11(3)7-16(14)20-9-13-8-15(17(18)19)12(4)21-13/h8,10-11,14,16H,5-7,9H2,1-4H3,(H,18,19) |
| InChIKey | RXGZHVAQUNSXLP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |