C16H18IN — CID 43483778
1-(2,5-dimethylphenyl)-1-(2-iodophenyl)-N-methylmethanamine (PubChem CID 43483778) has the molecular formula C16H18IN and a molecular weight of 351.23 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-1-(2-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-1-(2-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43483778 |
| Molecular Formula | C16H18IN |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-1-(2-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)ccc1C)c1ccccc1I |
| InChI | InChI=1S/C16H18IN/c1-11-8-9-12(2)14(10-11)16(18-3)13-6-4-5-7-15(13)17/h4-10,16,18H,1-3H3 |
| InChIKey | FZYIKFQTBAFAJQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|