C17H20INO — CID 83057061
1-(2-iodophenyl)-1-(4-methoxy-3,5-dimethylphenyl)-N-methylmethanamine (PubChem CID 83057061) has the molecular formula C17H20INO and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-(2-iodophenyl)-1-(4-methoxy-3,5-dimethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-iodophenyl)-1-(4-methoxy-3,5-dimethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83057061 |
| Molecular Formula | C17H20INO |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-(2-iodophenyl)-1-(4-methoxy-3,5-dimethylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)c(OC)c(C)c1)c1ccccc1I |
| InChI | InChI=1S/C17H20INO/c1-11-9-13(10-12(2)17(11)20-4)16(19-3)14-7-5-6-8-15(14)18/h5-10,16,19H,1-4H3 |
| InChIKey | AZJJNPCIJAHBSE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|