C18H20IN — CID 105053633
1-(3-cyclobutylphenyl)-1-(2-iodophenyl)-N-methylmethanamine (PubChem CID 105053633) has the molecular formula C18H20IN and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-1-(2-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(3-cyclobutylphenyl)-1-(2-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105053633 |
| Molecular Formula | C18H20IN |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-1-(2-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(C2CCC2)c1)c1ccccc1I |
| InChI | InChI=1S/C18H20IN/c1-20-18(16-10-2-3-11-17(16)19)15-9-5-8-14(12-15)13-6-4-7-13/h2-3,5,8-13,18,20H,4,6-7H2,1H3 |
| InChIKey | KCAATDHYPNZDIM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|